Características Generales
| NatID | 976 |
| Nombre Común | NatID_976 |
| Fórmula Molecular | C16H22O4 |
| Tipo Químico | Prenol lipids > Terpene lactones |
| Peso Molecular | 278.152 g/mol |
| Otros nombres |
Representaciones
| Smiles | COCC1C(=O)O[C@H]2C[C@H](C)C(C=CC(C)=O)=CC[C@H]12 |
| Inchi | InChI=1S/C16H22O4/c1-10-8-15-13(14(9-19-3)16(18)20-15)7-6-12(10)5-4-11(2)17/h4-6,10,13-15H,7-9H2,1-3H3/t10-,13+,14?,15-/m0/s1 |
| Inchi Key | DPCBZWUMLOLZBR-ZPDOSGOPSA-N |
| Estructura 3D |
Propiedades calculadas
| clogP | 2.29 |
| TPSA | 52.60 |
| HBD | 0 |
| HBA | 4 |
| Enlaces Rotables | 4 |
| Anillos aromáticos | 0 |
| Átomos pesados | 20 |
| Carbociclos Aromáticos | 0 |
| Heterociclos Aromáticos | 0 |
| Número de NO | 4 |
Experimentos
| EID | Fuente | Semisintético? | Confidence level | Referencias |
|---|---|---|---|---|
| 9069 | Xanthium orientale | No | Very High | Favier, L. S., María, A. O. M., Wendel, G. H., Borkowski, E. J., Giordano, O. S., Pelzer, L., & Tonn, C. E. (2005). Anti-ulcerogenic activity of xanthanolide sesquiterpenes from Xanthium cavanillesii in rats. Journal of Ethnopharmacology, 100(3), 260–267. https://doi.org/10.1016/j.jep.2005.02.042 |
| Bioassay ID | NPASS ID | Target | Activity type | Activity |
|---|---|---|---|---|
| Loading... | ||||