NatID | 547 |
Nombre Común | 2β-hydroxy-2,3-dihydrohelenalin |
Fórmula Molecular | C15H20O5 |
Tipo Químico | Prenol lipids > Terpene lactones |
Peso Molecular | 280.131 g/mol |
Otros nombres |
Smiles | C=C1C(=O)O[C@@H]2C[C@@H](C)[C@@H]3C[C@H](O)C(=O)[C@@]3(C)[C@@H](O)[C@H]12 |
Inchi | InChI=1S/C15H20O5/c1-6-4-10-11(7(2)14(19)20-10)13(18)15(3)8(6)5-9(16)12(15)17/h6,8-11,13,16,18H,2,4-5H2,1,3H3/t6-,8+,9+,10-,11-,13+,15+/m1/s1 |
Inchi Key | WKZSMTLNPUJUTH-FKQHNVJZSA-N |
Estructura 3D |
clogP | 0.44 |
TPSA | 83.83 |
HBD | 2 |
HBA | 5 |
Enlaces Rotables | 0 |
Anillos aromáticos | 0 |
Átomos pesados | 20 |
Carbociclos Aromáticos | 0 |
Heterociclos Aromáticos | 0 |
Número de NO | 5 |
EID | Fuente | Semisintético? | Confidence level | Referencias |
---|---|---|---|---|
10034 | Gaillardia tontalensis | No | Unknown | Petenatti, E. M., Pestchanker, M. J., Del Vitto, L. A., & Guerreiro, E. (1996). Chemotaxonomy of the argentinian species of Gaillardia. Phytochemistry, 42(5), 1367–1368. https://doi.org/10.1016/0031-9422(96)00104-5 |
Bioassay ID | NPASS ID | Target | Activity type | Activity |
---|---|---|---|---|
Loading... |