| NatID | 501 |
| Nombre Común | nepetina |
| Fórmula Molecular | C16H12O7 |
| Tipo Químico | Flavonoids > O-methylated flavonoids |
| Peso Molecular | 316.058 g/mol |
| Otros nombres | nepetin |
| Smiles | COc1c(O)cc2oc(-c3ccc(O)c(O)c3)cc(=O)c2c1O |
| Inchi | InChI=1S/C16H12O7/c1-22-16-11(20)6-13-14(15(16)21)10(19)5-12(23-13)7-2-3-8(17)9(18)4-7/h2-6,17-18,20-21H,1H3 |
| Inchi Key | FHHSEFRSDKWJKJ-UHFFFAOYSA-N |
| Estructura 3D |
| clogP | 2.29 |
| TPSA | 120.36 |
| HBD | 4 |
| HBA | 7 |
| Enlaces Rotables | 2 |
| Anillos aromáticos | 3 |
| Átomos pesados | 23 |
| Carbociclos Aromáticos | 2 |
| Heterociclos Aromáticos | 1 |
| Número de NO | 7 |
| EID | Fuente | Semisintético? | Confidence level | Referencias |
|---|---|---|---|---|
| 10040 | Gaillardia tontalensis | No | Unknown | Petenatti, E. M., Pestchanker, M. J., Del Vitto, L. A., & Guerreiro, E. (1996). Chemotaxonomy of the argentinian species of Gaillardia. Phytochemistry, 42(5), 1367–1368. https://doi.org/10.1016/0031-9422(96)00104-5 |
| Bioassay ID | NPASS ID | Target | Activity type | Activity |
|---|---|---|---|---|
| Loading... | ||||