NatID | 158 |
Nombre Común | O-ethyl-ester-Aristolochic acid II |
Fórmula Molecular | C18H13NO6 |
Tipo Químico | Phenanthrenes and derivatives > Aristolochic acids and derivatives |
Peso Molecular | 339.074 g/mol |
Otros nombres | O-ethyl-ester-Aristolochic acid II |
Smiles | CCOC(=O)c1cc2c(c3c1c([N+](=O)[O-])cc1ccccc13)OCO2 |
Inchi | InChI=1S/C18H13NO6/c1-2-23-18(20)12-8-14-17(25-9-24-14)16-11-6-4-3-5-10(11)7-13(15(12)16)19(21)22/h3-8H,2,9H2,1H3 |
Inchi Key | XVQUXRYMTULQON-UHFFFAOYSA-N |
Estructura 3D |
clogP | 3.81 |
TPSA | 87.90 |
HBD | 0 |
HBA | 6 |
Enlaces Rotables | 3 |
Anillos aromáticos | 3 |
Átomos pesados | 25 |
Carbociclos Aromáticos | 3 |
Heterociclos Aromáticos | 0 |
Número de NO | 7 |
EID | Fuente | Semisintético? | Confidence level | Referencias |
---|---|---|---|---|
10003 | Aristolochia argentina | No | High | Priestap, H. A. (1989). 13C NMR spectroscopy of aristolochic acids and aristololactams. Magnetic Resonance in Chemistry, 27(5), 460–469. https://doi.org/10.1002/mrc.1260270508 |
Bioassay ID | NPASS ID | Target | Activity type | Activity |
---|---|---|---|---|
Loading... |