NatID | 141 |
Nombre Común | Aristololactam DII |
Fórmula Molecular | C17H11NO5 |
Tipo Químico | Phenanthrenes and derivatives > Phenanthrols |
Peso Molecular | 309.064 g/mol |
Otros nombres |
Smiles | COc1c(C(=O)O)c(O)c2c3c(cc4ccccc4c13)NC2=O |
Inchi | InChI=1S/C17H11NO5/c1-23-15-10-8-5-3-2-4-7(8)6-9-11(10)12(16(20)18-9)14(19)13(15)17(21)22/h2-6,19H,1H3,(H,18,20)(H,21,22) |
Inchi Key | ACJLYSKHXRZGJC-UHFFFAOYSA-N |
Estructura 3D |
clogP | 2.97 |
TPSA | 95.86 |
HBD | 3 |
HBA | 4 |
Enlaces Rotables | 2 |
Anillos aromáticos | 3 |
Átomos pesados | 23 |
Carbociclos Aromáticos | 3 |
Heterociclos Aromáticos | 0 |
Número de NO | 6 |
EID | Fuente | Semisintético? | Confidence level | Referencias |
---|---|---|---|---|
9813 | Aristolochia argentina | No | High | Priestap, H. A. (1987). Minor aristolochic acids from Aristolochia argentina and mass spectral analysis of aristolochic acids. Phytochemistry, 26(2), 518–529. https://doi.org/10.1016/s0031-9422(00)81447-8 |
Bioassay ID | NPASS ID | Target | Activity type | Activity |
---|---|---|---|---|
Loading... |