General Characteristics
| NatID | 321 |
| Common Name | Chemical transformation of Jaborosalactone 38: (20R, 22R)-5,6:12 α,21-diepoxy-17-hydroxy-12-methoxy-1-oxo-3-thiophenyl-witha-24-en-26,22-olide |
| Molecular Formula | C30H42O8 |
| Chemical Class | Steroids and steroid derivatives > Steroid lactones |
| Molecular Weight | 530.288 g/mol |
| Other names | (20R, 22R)-5,6:12 α,21-diepoxy-17-hydroxy-12-methoxy-1-oxo-3-thiophenyl-witha-24-en-26,22-olide |
Representations
| Smiles | CO[C@H]1CC(=O)[C@]2(C)[C@H]3C[C@]4(OC)OC[C@H]([C@H]5CC(C)=C(C)C(=O)O5)[C@]5(O)CC[C@H]([C@H]3C[C@H]3O[C@]32C1)[C@]45C |
| Inchi | InChI=1S/C30H42O8/c1-15-9-22(37-25(32)16(15)2)21-14-36-30(35-6)13-20-18(19-7-8-28(21,33)27(19,30)4)11-24-29(38-24)12-17(34-5)10-23(31)26(20,29)3/h17-22,24,33H,7-14H2,1-6H3/t17-,18+,19+,20-,21+,22+,24+,26-,27-,28+,29+,30-/m0/s1 |
| Inchi Key | SACLNUXANFUCOQ-QLMVTRBVSA-N |
| 3D Structure |
Calculated Properties
| clogP | 3.34 |
| TPSA | 103.82 |
| HBD | 1 |
| HBA | 8 |
| Rotatable Bonds | 3 |
| Aromatic Rings | 0 |
| Heavy Atoms | 38 |
| Aromatic Carbocycles | 0 |
| Aromatic Heterocycles | 0 |
| Number of NO | 8 |
Experiments
| EID | Source | Semisynthetic? | Confidence level | References |
|---|---|---|---|---|
| 9377 | Jaborosa rotacea | No | Unknown | García, M. E., Barboza, G. E., Oberti, J. C., Ríos-Luci, C., Padrón, J. M., Nicotra, V. E., Estévez-Braun, A., & Ravelo, A. G. (2012). Antiproliferative activity of withanolide derivatives from Jaborosa cabrerae and Jaborosa reflexa. Chemotaxonomic considerations. Phytochemistry, 76, 150–157. https://doi.org/10.1016/j.phytochem.2011.12.018 |
| Bioassay ID | NPASS ID | Target | Activity type | Activity |
|---|---|---|---|---|
| Loading... | ||||