| NatID | 295 |
| Common Name | 1,3-Dimethoxy-5-pentadecyl-benzene |
| Molecular Formula | C29H52O2 |
| Chemical Class | Benzene and substituted derivatives > Methoxybenzenes |
| Molecular Weight | 432.397 g/mol |
| Other names |
| Smiles | CCCCCCCCCCCCCCCCCCCCCc1cc(OC)cc(OC)c1 |
| Inchi | InChI=1S/C29H52O2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-27-24-28(30-2)26-29(25-27)31-3/h24-26H,4-23H2,1-3H3 |
| Inchi Key | CGHRAXIZYRXFKL-UHFFFAOYSA-N |
| 3D Structure |
| clogP | 9.68 |
| TPSA | 18.46 |
| HBD | 0 |
| HBA | 2 |
| Rotatable Bonds | 22 |
| Aromatic Rings | 1 |
| Heavy Atoms | 31 |
| Aromatic Carbocycles | 1 |
| Aromatic Heterocycles | 0 |
| Number of NO | 2 |
| EID | Source | Semisynthetic? | Confidence level | References |
|---|---|---|---|---|
| 9953 | Oxalis erythrorhiza | No | High | Feresin, G. E., Tapia, A., Sortino, M., Zacchino, S., Arias, A. R. de, Inchausti, A., Yaluff, G., Rodriguez, J., Theoduloz, C., & Schmeda-Hirschmann, G. (2003). Bioactive alkyl phenols and embelin from Oxalis erythrorhiza. Journal of Ethnopharmacology, 88(2–3), 241–247. https://doi.org/10.1016/s0378-8741(03)00258-7 |
| Bioassay ID | NPASS ID | Target | Activity type | Activity |
|---|---|---|---|---|
| Loading... | ||||