General Characteristics
| NatID | 241 |
| Common Name | Sabinene |
| Molecular Formula | C10H16 |
| Chemical Class | Prenol lipids > Monoterpenoids |
| Molecular Weight | 136.125 g/mol |
| Other names |
Representations
| Smiles | C=C1CC[C@@]2(C(C)C)C[C@@H]12 |
| Inchi | InChI=1S/C10H16/c1-7(2)10-5-4-8(3)9(10)6-10/h7,9H,3-6H2,1-2H3/t9-,10-/m0/s1 |
| Inchi Key | NDVASEGYNIMXJL-UWVGGRQHSA-N |
| 3D Structure |
Calculated Properties
| clogP | 3.00 |
| TPSA | 0.00 |
| HBD | 0 |
| HBA | 0 |
| Rotatable Bonds | 1 |
| Aromatic Rings | 0 |
| Heavy Atoms | 10 |
| Aromatic Carbocycles | 0 |
| Aromatic Heterocycles | 0 |
| Number of NO | 0 |
Experiments
| EID | Source | Semisynthetic? | Confidence level | References |
|---|---|---|---|---|
| 9913 | Gutierrezia mandonii | No | Unknown | Clemente, S. V., Mareggiani, G., Juárez, B. E., Mendiondo, M. E., van Baren, C. M., Lira, P. D. L., Broussalis, A. M., Bandoni, A. L., & Ferraro, G. E. (2008). Insecticidal Activity of the Essential Oil and Extracts ofGutierrezia mandoniiandG. repens(Asteraceae) Growing in Argentina. Journal of Essential Oil Research, 20(3), 276–278. https://doi.org/10.1080/10412905.2008.9700011 |
| Bioassay ID | NPASS ID | Target | Activity type | Activity |
|---|---|---|---|---|
| Loading... | ||||