NatID | 1758 |
Common Name | NatID_1758 |
Molecular Formula | C21H26O5 |
Chemical Class | |
Molecular Weight | 358.178 g/mol |
Other names | 68143-83-9 |
Smiles | C/C=C/c1ccc(O[C@@H](C)[C@@H](O)c2ccc(OC)c(OC)c2)c(OC)c1 |
Inchi | InChI=1S/C21H26O5/c1-6-7-15-8-10-18(19(12-15)24-4)26-14(2)21(22)16-9-11-17(23-3)20(13-16)25-5/h6-14,21-22H,1-5H3/b7-6+/t14-,21+/m0/s1 |
Inchi Key | NUDWCJJMQATDKB-NPNYKPOCSA-N |
3D Structure |
clogP | 4.25 |
TPSA | 57.15 |
HBD | 1 |
HBA | 5 |
Rotatable Bonds | 8 |
Aromatic Rings | 2 |
Heavy Atoms | 26 |
Aromatic Carbocycles | 2 |
Aromatic Heterocycles | 0 |
Number of NO | 5 |
EID | Source | Semisynthetic? | Confidence level | References |
---|---|---|---|---|
10482 | Virola surinamensis | No | Low | Zacchino, S. A. (1994). Enantioselective Route to Threo 8.0.4’-Type Neolignans: Synthesis of (-)-Virolin. Journal of Natural Products, 57(4), 446–451. https://doi.org/10.1021/np50106a002 |
Bioassay ID | NPASS ID | Target | Activity type | Activity |
---|---|---|---|---|
Loading... |