NatID | 160 |
Common Name | Aristololactam CIII |
Molecular Formula | C19H17NO5 |
Chemical Class | Aristolactams |
Molecular Weight | 339.111 g/mol |
Other names |
Smiles | COc1ccc2cc3c4c(c(CO)c(OC)c(OC)c4c2c1)C(=O)N3 |
Inchi | InChI=1S/C19H17NO5/c1-23-10-5-4-9-6-13-16-14(11(9)7-10)18(25-3)17(24-2)12(8-21)15(16)19(22)20-13/h4-7,21H,8H2,1-3H3,(H,20,22) |
Inchi Key | SEFRVZVTQHSNOP-UHFFFAOYSA-N |
3D Structure |
clogP | 3.08 |
TPSA | 77.02 |
HBD | 2 |
HBA | 5 |
Rotatable Bonds | 4 |
Aromatic Rings | 3 |
Heavy Atoms | 25 |
Aromatic Carbocycles | 3 |
Aromatic Heterocycles | 0 |
Number of NO | 6 |
EID | Source | Semisynthetic? | Confidence level | References |
---|---|---|---|---|
10004 | Aristolochia argentina | No | High | Priestap, H. A. (1989). 13C NMR spectroscopy of aristolochic acids and aristololactams. Magnetic Resonance in Chemistry, 27(5), 460–469. https://doi.org/10.1002/mrc.1260270508 |
Bioassay ID | NPASS ID | Target | Activity type | Activity |
---|---|---|---|---|
Loading... |