NatID | 1562 |
Common Name | NatID_1562 |
Molecular Formula | C7H7NO2 |
Chemical Class | |
Molecular Weight | 137.048 g/mol |
Other names | 535-83-1 |
Smiles | C[n+]1cccc(C(=O)[O-])c1 |
Inchi | InChI=1S/C7H7NO2/c1-8-4-2-3-6(5-8)7(9)10/h2-5H,1H3 |
Inchi Key | WWNNZCOKKKDOPX-UHFFFAOYSA-N |
3D Structure |
clogP | -1.13 |
TPSA | 44.01 |
HBD | 0 |
HBA | 2 |
Rotatable Bonds | 1 |
Aromatic Rings | 1 |
Heavy Atoms | 10 |
Aromatic Carbocycles | 0 |
Aromatic Heterocycles | 1 |
Number of NO | 3 |
EID | Source | Semisynthetic? | Confidence level | References |
---|---|---|---|---|
10244 | Bauhinia forficata subsp. pruinosa | No | Low | Iribarren, A. M., & Pomilio, A. B. (1983). Components of Bauhinia candicans. Journal of Natural Products, 46(5), 752–753. https://doi.org/10.1021/np50029a028 |
Bioassay ID | NPASS ID | Target | Activity type | Activity |
---|---|---|---|---|
Loading... |