NatID | 127 |
Common Name | Aristololactam III |
Molecular Formula | C17H11NO4 |
Chemical Class | Phenanthrenes and derivatives |
Molecular Weight | 293.069 g/mol |
Other names |
Smiles | COc1ccc2cc3c4c(cc5c(c4c2c1)OCO5)C(=O)N3 |
Inchi | InChI=1S/C17H11NO4/c1-20-9-3-2-8-4-12-14-11(17(19)18-12)6-13-16(22-7-21-13)15(14)10(8)5-9/h2-6H,7H2,1H3,(H,18,19) |
Inchi Key | LUASRNDIAICNKN-UHFFFAOYSA-N |
3D Structure |
clogP | 3.30 |
TPSA | 56.79 |
HBD | 1 |
HBA | 4 |
Rotatable Bonds | 1 |
Aromatic Rings | 3 |
Heavy Atoms | 22 |
Aromatic Carbocycles | 3 |
Aromatic Heterocycles | 0 |
Number of NO | 5 |
EID | Source | Semisynthetic? | Confidence level | References |
---|---|---|---|---|
9879 | Aristolochia argentina | No | High | A. Priestap, H. (1985). Seven aristololactams from Aristolochia argentina. Phytochemistry, 24(4), 849–852. https://doi.org/10.1016/s0031-9422(00)84905-5 |
Bioassay ID | NPASS ID | Target | Activity type | Activity |
---|---|---|---|---|
Loading... |