| NatID | 1252 |
| Common Name | NatID_1252 |
| Molecular Formula | C21H24O6 |
| Chemical Class | Prenol lipids > Terpene lactones |
| Molecular Weight | 372.157 g/mol |
| Other names |
| Smiles | C=C1C[C@@H](OC(=O)C2=CC(OC)OC2)[C@H]2C(=C)C(=O)O[C@@H]2/C=C(/C)[C@@H]2C[C@H]12 |
| Inchi | InChI=1S/C21H24O6/c1-10-5-16-19(12(3)20(22)26-16)17(6-11(2)15-8-14(10)15)27-21(23)13-7-18(24-4)25-9-13/h5,7,14-19H,2-3,6,8-9H2,1,4H3/b10-5-/t14-,15+,16+,17+,18?,19-/m0/s1 |
| Inchi Key | XFPZGEOIWPLKLK-SUHGNQEBSA-N |
| 3D Structure |
| clogP | 2.47 |
| TPSA | 71.06 |
| HBD | 0 |
| HBA | 6 |
| Rotatable Bonds | 3 |
| Aromatic Rings | 0 |
| Heavy Atoms | 27 |
| Aromatic Carbocycles | 0 |
| Aromatic Heterocycles | 0 |
| Number of NO | 6 |
| EID | Source | Semisynthetic? | Confidence level | References |
|---|---|---|---|---|
| 9542 | Disynaphia multicrenulata | No | Very High | de Gutierrez, A. N., Bardón, A., Catalán, C. A. N., Gedris, T. B., & Herz, W. (2001). Sesquiterpene lactones and other constituents of Disynaphia multicrenulata from Argentina. Biochemical Systematics and Ecology, 29(6), 633–647. https://doi.org/10.1016/s0305-1978(00)00092-2 |
| Bioassay ID | NPASS ID | Target | Activity type | Activity |
|---|---|---|---|---|
| Loading... | ||||