General Characteristics
| NatID | 1202 |
| Common Name | NatID_1202 |
| Molecular Formula | C21H32Br2O |
| Chemical Class | Prenol lipids > Diterpenoids |
| Molecular Weight | 458.082 g/mol |
| Other names |
Representations
| Smiles | CC1=CC[C@H]2C(C)(C)CCC[C@]2(C)[C@@]12CC[C@@](C)(CC=C(Br)Br)O2 |
| Inchi | InChI=1S/C21H32Br2O/c1-15-7-8-16-18(2,3)10-6-11-20(16,5)21(15)14-13-19(4,24-21)12-9-17(22)23/h7,9,16H,6,8,10-14H2,1-5H3/t16-,19+,20-,21+/m0/s1 |
| Inchi Key | WPGOAZOYDIVLNR-NASSWSRMSA-N |
| 3D Structure |
Calculated Properties
| clogP | 7.50 |
| TPSA | 9.23 |
| HBD | 0 |
| HBA | 1 |
| Rotatable Bonds | 2 |
| Aromatic Rings | 0 |
| Heavy Atoms | 24 |
| Aromatic Carbocycles | 0 |
| Aromatic Heterocycles | 0 |
| Number of NO | 1 |
Experiments
| EID | Source | Semisynthetic? | Confidence level | References |
|---|---|---|---|---|
| 9463 | Grindelia pulchella | No | Very High | Reta, G. F., Chiaramello, A. I., García, C., León, L. G., Martín, V. S., Padrón, J. M., Tonn, C. E., & Donadel, O. J. (2013). Derivatives of grindelic acid: From a non-active natural diterpene to synthetic antitumor derivatives. European Journal of Medicinal Chemistry, 67, 28–38. https://doi.org/10.1016/j.ejmech.2013.06.013 |
| Bioassay ID | NPASS ID | Target | Activity type | Activity |
|---|---|---|---|---|
| Loading... | ||||