NatID | 1073 |
Common Name | NatID_1073 |
Molecular Formula | C10H18O2 |
Chemical Class | Tetrahydrofurans |
Molecular Weight | 170.131 g/mol |
Other names |
Smiles | C=C[C@]1(C)CC[C@H](C(C)(C)O)O1 |
Inchi | InChI=1S/C10H18O2/c1-5-10(4)7-6-8(12-10)9(2,3)11/h5,8,11H,1,6-7H2,2-4H3/t8-,10-/m1/s1 |
Inchi Key | BRHDDEIRQPDPMG-PSASIEDQSA-N |
3D Structure |
clogP | 1.88 |
TPSA | 29.46 |
HBD | 1 |
HBA | 2 |
Rotatable Bonds | 2 |
Aromatic Rings | 0 |
Heavy Atoms | 12 |
Aromatic Carbocycles | 0 |
Aromatic Heterocycles | 0 |
Number of NO | 2 |
EID | Source | Semisynthetic? | Confidence level | References |
---|---|---|---|---|
9219 | Lippia integrifolia | No | Unknown | del C. Coronel, A., Cerda-García-Rojas, C. M., Joseph-Nathan, P., & Catalán, C. A. N. (2006). Chemical composition, seasonal variation and a new sesquiterpene alcohol from the essential oil ofLippia integrifolia. Flavour and Fragrance Journal, 21(5), 839–847. https://doi.org/10.1002/ffj.1736 |
Bioassay ID | NPASS ID | Target | Activity type | Activity |
---|---|---|---|---|
Loading... |