| NatID | 1056 |
| Common Name | NatID_1056 |
| Molecular Formula | C20H36O3 |
| Chemical Class | Prenol lipids > Diterpenoids |
| Molecular Weight | 324.266 g/mol |
| Other names |
| Smiles | C=C[C@](C)(O)CC[C@@]1(C)[C@H](C)CC[C@]2(C)[C@@H]1CC[C@@H](O)[C@]2(C)O |
| Inchi | InChI=1S/C20H36O3/c1-7-17(3,22)12-13-18(4)14(2)10-11-19(5)15(18)8-9-16(21)20(19,6)23/h7,14-16,21-23H,1,8-13H2,2-6H3/t14-,15-,16-,17+,18+,19-,20+/m1/s1 |
| Inchi Key | BBYQYMNXQRGCRE-DUBPVYKHSA-N |
| 3D Structure |
| clogP | 3.67 |
| TPSA | 60.69 |
| HBD | 3 |
| HBA | 3 |
| Rotatable Bonds | 4 |
| Aromatic Rings | 0 |
| Heavy Atoms | 23 |
| Aromatic Carbocycles | 0 |
| Aromatic Heterocycles | 0 |
| Number of NO | 3 |
| EID | Source | Semisynthetic? | Confidence level | References |
|---|---|---|---|---|
| 9188 | Aldama tucumanensis | No | Very High | Vaccarini, C. E., Palacios, S. M., Meragelman, K. M., & Sosa, V. E. (2002). Antifeedant Activity of Metabolites from Viguiera Tucumanensis. Natural Product Letters, 16(5), 323–327. https://doi.org/10.1080/10575630290030711 |
| Bioassay ID | NPASS ID | Target | Activity type | Activity |
|---|---|---|---|---|
| Loading... | ||||